Aldrin

| StdInChI = 1S/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2/t4-,5+,6+,7-,10+,11- | StdInChIKey_Ref = | StdInChIKey = QBYJBZPUGVGKQQ-SJJAEHHWSA-N | CASNo_Ref = | CASNo = 309-00-2 | UNII_Ref = | UNII = OZE3CLY605 | SMILES = ClC4(Cl)[C@@]2(Cl)C(/Cl)=C(/Cl)[C@]4(Cl)[C@@H]3[C@@H]\1C[C@@H](/C=C/1)[C@H]23 | ChemSpiderID_Ref = | ChemSpiderID=10292747 | KEGG_Ref = | KEGG = C07552 | PubChem = 2087 | EC_number = 206-215-8 | RTECS = IO2100000 | UNNumber = 2762, 2761 | ChEBI = 2564 | ChEMBL = 195953 }} | Section2 = | Section6 = | Section7 = | GHSSignalWord = Danger | HPhrases = | PPhrases = | PEL = TWA 0.25 mg/m3 [skin] | REL = Ca TWA 0.25 mg/m3 [skin] | IDLH = 25 mg/m3 | MainHazards = Toxic and is a suspected human carcinogen | LD50 = 50 mg/kg (rabbit, oral)
33 mg/kg (guinea pig, oral)
39 mg/kg (rat, oral)
44 mg/kg (mouse, oral) | LCLo = 5.8 mg/m3 (rat, 4 hr) }} }}

Aldrin is an organochlorine insecticide that was widely used until the 1990s, when it was banned in most countries. Aldrin is a member of the so-called "classic organochlorines" (COC) group of pesticides. COCs enjoyed a very sharp rise in popularity during and after World War II. Other noteworthy examples of COCs include dieldrin and DDT. After research showed that organochlorines can be highly toxic to the ecosystem through bioaccumulation, most were banned from use. Before the ban, it was heavily used as a pesticide to treat seed and soil. Aldrin and related "cyclodiene" pesticides (a term for pesticides derived from Hexachlorocyclopentadiene) became notorious as persistent organic pollutants. Provided by Wikipedia
Showing 1 - 6 results of 6 for search 'Aldrin', query time: 0.01s Refine Results
  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
    Published 2019
    Other Authors: “…Aldrin…”
  6. 6
    Published 2006
    Other Authors: “…Aldrin Abdullah…”
Search Tools: RSS Feed Email Search